C32H36N4O11 — CID 173199149
(2S,3S)-2,3-dibenzoyloxybutanedioic acid;N'-[(2S)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidamide (PubChem CID 173199149) has the molecular formula C32H36N4O11 and a molecular weight of 652.66 g/mol. Its IUPAC name is (2S,3S)-2,3-dibenzoyloxybutanedioic acid;N'-[(2S)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidamide.
| Compound Name | (2S,3S)-2,3-dibenzoyloxybutanedioic acid;N'-[(2S)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidamide |
|---|---|
| PubChem CID | 173199149 |
| Molecular Formula | C32H36N4O11 |
| Molecular Weight | 652.66 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | (2S,3S)-2,3-dibenzoyloxybutanedioic acid;N'-[(2S)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidamide |
| SMILES | NC(=NOC[C@@H](O)CN1CCCCC1)c1ccc[n+]([O-])c1.O=C(O[C@H](C(=O)O)[C@H](OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C14H22N4O3/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12;15-14(12-5-4-8-18(20)9-12)16-21-11-13(19)10-17-6-2-1-3-7-17/h1-10,13-14H,(H,19,20)(H,21,22);4-5,8-9,13,19H,1-3,6-7,10-11H2,(H2,15,16)/t13-,14-;13-/m00/s1 |
| InChIKey | ZNIMPZRQKXBEQX-NGEMZOBVSA-N |
| XLogP | 1.41 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.66 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|