About 5-methyl-2H-tetrazole;propan-2-amine
5-methyl-2H-tetrazole;propan-2-amine (PubChem CID 173199638) has the molecular formula C5H13N5
and a molecular weight of 143.19 g/mol. Its IUPAC name is 5-methyl-2H-tetrazole;propan-2-amine.
Molecular Properties
| Compound Name | 5-methyl-2H-tetrazole;propan-2-amine |
| PubChem CID | 173199638 |
| Molecular Formula | C5H13N5 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.12 |
| IUPAC Name | 5-methyl-2H-tetrazole;propan-2-amine |
| SMILES | CC(C)N.Cc1nn[nH]n1 |
| InChI | InChI=1S/C3H9N.C2H4N4/c1-3(2)4;1-2-3-5-6-4-2/h3H,4H2,1-2H3;1H3,(H,3,4,5,6) |
| InChIKey | WEEJRWDLYAQZIO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2H-tetrazole;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2H-tetrazole;propan-2-amine?
The IUPAC name of 5-methyl-2H-tetrazole;propan-2-amine (CID 173199638) is 5-methyl-2H-tetrazole;propan-2-amine.
What is the SMILES notation for 5-methyl-2H-tetrazole;propan-2-amine?
The canonical SMILES for 5-methyl-2H-tetrazole;propan-2-amine is CC(C)N.Cc1nn[nH]n1.
What is the InChIKey of 5-methyl-2H-tetrazole;propan-2-amine?
The InChIKey is WEEJRWDLYAQZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H4N4/c1-3(2)4;1-2-3-5-6-4-2/h3H,4H2,1-2H3;1H3,(H,3,4,5,6).
What are the key properties of 5-methyl-2H-tetrazole;propan-2-amine?
5-methyl-2H-tetrazole;propan-2-amine has a molecular weight of 143.19 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2H-tetrazole;propan-2-amine is sourced from PubChem (CID 173199638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).