C24H44O7Si — CID 173199770
tert-butyl 2-[acetyloxy-[5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate (PubChem CID 173199770) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is tert-butyl 2-[acetyloxy-[5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[acetyloxy-[5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 173199770 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | tert-butyl 2-[acetyloxy-[5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(OC(C)=O)C1OC(CC)(CC)OC1C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C24H44O7Si/c1-13-24(14-2)28-18(19(29-24)20(22(5,6)7)31-32(11)12)17(27-16(4)25)15(3)21(26)30-23(8,9)10/h17-20,32H,3,13-14H2,1-2,4-12H3 |
| InChIKey | JUIXRTVZYSWZGP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|