About 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline
9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline (PubChem CID 173200392) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline.
Molecular Properties
| Compound Name | 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline |
| PubChem CID | 173200392 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline |
| SMILES | C1=CC2=C(Cc3ccccc3)C3=COCC3=NC2C=C1 |
| InChI | InChI=1S/C18H15NO/c1-2-6-13(7-3-1)10-15-14-8-4-5-9-17(14)19-18-12-20-11-16(15)18/h1-9,11,17H,10,12H2 |
| InChIKey | FGWAWTZYAYPWNZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline?
The IUPAC name of 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline (CID 173200392) is 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline.
What is the SMILES notation for 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline?
The canonical SMILES for 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline is C1=CC2=C(Cc3ccccc3)C3=COCC3=NC2C=C1.
What is the InChIKey of 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline?
The InChIKey is FGWAWTZYAYPWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO/c1-2-6-13(7-3-1)10-15-14-8-4-5-9-17(14)19-18-12-20-11-16(15)18/h1-9,11,17H,10,12H2.
What are the key properties of 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline?
9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline has a molecular weight of 261.32 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-3,4a-dihydrofuro[3,4-b]quinoline is sourced from PubChem (CID 173200392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).