molecular hydrogen;phosphorous acid

H5O3P — CID 173200559

IUPACmolecular hydrogen;phosphorous acid
SMILESOP(O)O.[H][H]
InChIInChI=1S/H3O3P.H2/c1-4(2)3;/h1-3H;1H
InChIKeyCSVVBBOBDBMFIU-UHFFFAOYSA-N
MW84.01 g/mol
LogP-0.56
Rot. Bonds

About molecular hydrogen;phosphorous acid

molecular hydrogen;phosphorous acid (PubChem CID 173200559) has the molecular formula H5O3P and a molecular weight of 84.01 g/mol. Its IUPAC name is molecular hydrogen;phosphorous acid.

Molecular Properties

Compound Namemolecular hydrogen;phosphorous acid
PubChem CID173200559
Molecular FormulaH5O3P
Molecular Weight84.01 g/mol
Exact Mass84.00
IUPAC Namemolecular hydrogen;phosphorous acid
SMILESOP(O)O.[H][H]
InChIInChI=1S/H3O3P.H2/c1-4(2)3;/h1-3H;1H
InChIKeyCSVVBBOBDBMFIU-UHFFFAOYSA-N
XLogP-0.56
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50084.01
LogP ≤ 5-0.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze molecular hydrogen;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;phosphorous acid?
The IUPAC name of molecular hydrogen;phosphorous acid (CID 173200559) is molecular hydrogen;phosphorous acid.
What is the SMILES notation for molecular hydrogen;phosphorous acid?
The canonical SMILES for molecular hydrogen;phosphorous acid is OP(O)O.[H][H].
What is the InChIKey of molecular hydrogen;phosphorous acid?
The InChIKey is CSVVBBOBDBMFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O3P.H2/c1-4(2)3;/h1-3H;1H.
What are the key properties of molecular hydrogen;phosphorous acid?
molecular hydrogen;phosphorous acid has a molecular weight of 84.01 g/mol, XLogP of -0.56, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;phosphorous acid is sourced from PubChem (CID 173200559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).