About 4-(pyridin-4-ylmethyl)-1,3-oxazole
4-(pyridin-4-ylmethyl)-1,3-oxazole (PubChem CID 173201364) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 4-(pyridin-4-ylmethyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(pyridin-4-ylmethyl)-1,3-oxazole |
| PubChem CID | 173201364 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 4-(pyridin-4-ylmethyl)-1,3-oxazole |
| SMILES | c1cc(Cc2cocn2)ccn1 |
| InChI | InChI=1S/C9H8N2O/c1-3-10-4-2-8(1)5-9-6-12-7-11-9/h1-4,6-7H,5H2 |
| InChIKey | YQTBMBHKVDMDTI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(pyridin-4-ylmethyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(pyridin-4-ylmethyl)-1,3-oxazole?
The IUPAC name of 4-(pyridin-4-ylmethyl)-1,3-oxazole (CID 173201364) is 4-(pyridin-4-ylmethyl)-1,3-oxazole.
What is the SMILES notation for 4-(pyridin-4-ylmethyl)-1,3-oxazole?
The canonical SMILES for 4-(pyridin-4-ylmethyl)-1,3-oxazole is c1cc(Cc2cocn2)ccn1.
What is the InChIKey of 4-(pyridin-4-ylmethyl)-1,3-oxazole?
The InChIKey is YQTBMBHKVDMDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c1-3-10-4-2-8(1)5-9-6-12-7-11-9/h1-4,6-7H,5H2.
What are the key properties of 4-(pyridin-4-ylmethyl)-1,3-oxazole?
4-(pyridin-4-ylmethyl)-1,3-oxazole has a molecular weight of 160.18 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(pyridin-4-ylmethyl)-1,3-oxazole is sourced from PubChem (CID 173201364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).