About 6-ethynylnon-3-yne
6-ethynylnon-3-yne (PubChem CID 173201509) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 6-ethynylnon-3-yne.
Molecular Properties
| Compound Name | 6-ethynylnon-3-yne |
| PubChem CID | 173201509 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 6-ethynylnon-3-yne |
| SMILES | C#CC(CC#CCC)CCC |
| InChI | InChI=1S/C11H16/c1-4-7-8-10-11(6-3)9-5-2/h3,11H,4-5,9-10H2,1-2H3 |
| InChIKey | QAAHBKHVUFKADU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynylnon-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynylnon-3-yne?
The IUPAC name of 6-ethynylnon-3-yne (CID 173201509) is 6-ethynylnon-3-yne.
What is the SMILES notation for 6-ethynylnon-3-yne?
The canonical SMILES for 6-ethynylnon-3-yne is C#CC(CC#CCC)CCC.
What is the InChIKey of 6-ethynylnon-3-yne?
The InChIKey is QAAHBKHVUFKADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-4-7-8-10-11(6-3)9-5-2/h3,11H,4-5,9-10H2,1-2H3.
What are the key properties of 6-ethynylnon-3-yne?
6-ethynylnon-3-yne has a molecular weight of 148.25 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynylnon-3-yne is sourced from PubChem (CID 173201509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).