C35H48N4O4 — CID 173201773
(3R)-1-butyl-9-[[4-(N-ethoxy-C-phenylcarbonimidoyl)phenyl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 173201773) has the molecular formula C35H48N4O4 and a molecular weight of 588.79 g/mol. Its IUPAC name is (3R)-1-butyl-9-[[4-(N-ethoxy-C-phenylcarbonimidoyl)phenyl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3R)-1-butyl-9-[[4-(N-ethoxy-C-phenylcarbonimidoyl)phenyl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 173201773 |
| Molecular Formula | C35H48N4O4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | (3R)-1-butyl-9-[[4-(N-ethoxy-C-phenylcarbonimidoyl)phenyl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@@H](CC2(O)CCCCC2)NC(=O)C12CCN(Cc1ccc(C(=NOCC)c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C35H48N4O4/c1-3-5-22-39-32(40)30(25-34(42)18-10-7-11-19-34)36-33(41)35(39)20-23-38(24-21-35)26-27-14-16-29(17-15-27)31(37-43-4-2)28-12-8-6-9-13-28/h6,8-9,12-17,30,42H,3-5,7,10-11,18-26H2,1-2H3,(H,36,41)/t30-/m1/s1 |
| InChIKey | CLQMMZVTMOPNGS-SSEXGKCCSA-N |
| XLogP | 5.02 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|