C25H26N2O7 — CID 173202654
ethyl 1-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-nitrophenyl]prop-2-enoyl]piperidine-2-carboxylate (PubChem CID 173202654) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is ethyl 1-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-nitrophenyl]prop-2-enoyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-nitrophenyl]prop-2-enoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 173202654 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | ethyl 1-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-nitrophenyl]prop-2-enoyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)/C=C/c1cccc([N+](=O)[O-])c1-c1ccc2c(c1)CCOO2 |
| InChI | InChI=1S/C25H26N2O7/c1-2-32-25(29)21-7-3-4-14-26(21)23(28)12-10-17-6-5-8-20(27(30)31)24(17)19-9-11-22-18(16-19)13-15-33-34-22/h5-6,8-12,16,21H,2-4,7,13-15H2,1H3/b12-10+ |
| InChIKey | CAORJPHAAVKLSL-ZRDIBKRKSA-N |
| XLogP | 4.09 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|