C6H4BrF3N4 — CID 173203016
7-bromo-3-(trifluoromethyl)-4H-imidazo[2,1-f][1,2,4]triazine (PubChem CID 173203016) has the molecular formula C6H4BrF3N4 and a molecular weight of 269.02 g/mol. Its IUPAC name is 7-bromo-3-(trifluoromethyl)-4H-imidazo[2,1-f][1,2,4]triazine.
| Compound Name | 7-bromo-3-(trifluoromethyl)-4H-imidazo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 173203016 |
| Molecular Formula | C6H4BrF3N4 |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 7-bromo-3-(trifluoromethyl)-4H-imidazo[2,1-f][1,2,4]triazine |
| SMILES | FC(F)(F)N1C=Nn2c(Br)cnc2C1 |
| InChI | InChI=1S/C6H4BrF3N4/c7-4-1-11-5-2-13(6(8,9)10)3-12-14(4)5/h1,3H,2H2 |
| InChIKey | DFTMDHJKUHAWJH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|