C4H13FO3Si3 — CID 173203649
4-fluoro-2-methyl-2-propyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 173203649) has the molecular formula C4H13FO3Si3 and a molecular weight of 212.40 g/mol. Its IUPAC name is 4-fluoro-2-methyl-2-propyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 4-fluoro-2-methyl-2-propyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 173203649 |
| Molecular Formula | C4H13FO3Si3 |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 4-fluoro-2-methyl-2-propyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CCC[Si]1(C)O[SiH2]O[SiH](F)O1 |
| InChI | InChI=1S/C4H13FO3Si3/c1-3-4-11(2)7-9-6-10(5)8-11/h10H,3-4,9H2,1-2H3 |
| InChIKey | IPKWBZGLNBJIBR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|