C10H15V- — CID 173203726
1,2,3,5,5-pentamethylcyclopenta-1,3-diene;vanadium (PubChem CID 173203726) has the molecular formula C10H15V- and a molecular weight of 186.17 g/mol. Its IUPAC name is 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;vanadium.
| Compound Name | 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;vanadium |
|---|---|
| PubChem CID | 173203726 |
| Molecular Formula | C10H15V- |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;vanadium |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.[V] |
| InChI | InChI=1S/C10H15.V/c1-7-6-10(4,5)9(3)8(7)2;/h1-5H3;/q-1; |
| InChIKey | KIUUZWCHXPEMLN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|