About CID 173204104
CID 173204104 (PubChem CID 173204104) has the molecular formula H2ClCsO3
and a molecular weight of 218.37 g/mol.
Molecular Properties
| Compound Name | CID 173204104 |
| PubChem CID | 173204104 |
| Molecular Formula | H2ClCsO3 |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 217.87 |
| IUPAC Name | — |
| SMILES | [Cs+].[H-].[O-][Cl+2]([O-])O |
| InChI | InChI=1S/ClHO3.Cs.H/c2-1(3)4;;/h2H;;/q;+1;-1 |
| InChIKey | FYBPJZWBNXEFJA-UHFFFAOYSA-N |
| XLogP | -5.82 |
| TPSA | 66.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 173204104 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173204104?
The IUPAC name of CID 173204104 (CID 173204104) is not available.
What is the SMILES notation for CID 173204104?
The canonical SMILES for CID 173204104 is [Cs+].[H-].[O-][Cl+2]([O-])O.
What is the InChIKey of CID 173204104?
The InChIKey is FYBPJZWBNXEFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO3.Cs.H/c2-1(3)4;;/h2H;;/q;+1;-1.
What are the key properties of CID 173204104?
CID 173204104 has a molecular weight of 218.37 g/mol, XLogP of -5.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173204104 is sourced from PubChem (CID 173204104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).