C29H30 — CID 173204757
[(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]benzene (PubChem CID 173204757) has the molecular formula C29H30 and a molecular weight of 378.56 g/mol. Its IUPAC name is [(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]benzene.
| Compound Name | [(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 173204757 |
| Molecular Formula | C29H30 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]benzene |
| SMILES | CC1=C(C)C(C)(C)C(C(c2ccccc2)(c2ccccc2)c2ccccc2)=C1C |
| InChI | InChI=1S/C29H30/c1-21-22(2)27(28(4,5)23(21)3)29(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20H,1-5H3 |
| InChIKey | CXWITXZZZAIJKH-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|