About 2,3,4-trifluoro-1H-indene
2,3,4-trifluoro-1H-indene (PubChem CID 173206263) has the molecular formula C9H5F3
and a molecular weight of 170.13 g/mol. Its IUPAC name is 2,3,4-trifluoro-1H-indene.
Molecular Properties
| Compound Name | 2,3,4-trifluoro-1H-indene |
| PubChem CID | 173206263 |
| Molecular Formula | C9H5F3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2,3,4-trifluoro-1H-indene |
| SMILES | FC1=C(F)c2c(F)cccc2C1 |
| InChI | InChI=1S/C9H5F3/c10-6-3-1-2-5-4-7(11)9(12)8(5)6/h1-3H,4H2 |
| InChIKey | DFDVCWZRXZAJNX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3,4-trifluoro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trifluoro-1H-indene?
The IUPAC name of 2,3,4-trifluoro-1H-indene (CID 173206263) is 2,3,4-trifluoro-1H-indene.
What is the SMILES notation for 2,3,4-trifluoro-1H-indene?
The canonical SMILES for 2,3,4-trifluoro-1H-indene is FC1=C(F)c2c(F)cccc2C1.
What is the InChIKey of 2,3,4-trifluoro-1H-indene?
The InChIKey is DFDVCWZRXZAJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3/c10-6-3-1-2-5-4-7(11)9(12)8(5)6/h1-3H,4H2.
What are the key properties of 2,3,4-trifluoro-1H-indene?
2,3,4-trifluoro-1H-indene has a molecular weight of 170.13 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trifluoro-1H-indene is sourced from PubChem (CID 173206263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).