About dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone
dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone (PubChem CID 173206663) has the molecular formula C12H24O4Si
and a molecular weight of 260.41 g/mol. Its IUPAC name is dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone.
Molecular Properties
| Compound Name | dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone |
| PubChem CID | 173206663 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone |
| SMILES | CC1OC[C@@H](OC(C)(C)C)[C@H](C(=O)[SiH](C)C)O1 |
| InChI | InChI=1S/C12H24O4Si/c1-8-14-7-9(16-12(2,3)4)10(15-8)11(13)17(5)6/h8-10,17H,7H2,1-6H3/t8?,9-,10-/m1/s1 |
| InChIKey | OAFFUSOKCPWHGW-VXRWAFEHSA-N |
| XLogP | 1.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone?
The IUPAC name of dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone (CID 173206663) is dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone.
What is the SMILES notation for dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone?
The canonical SMILES for dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone is CC1OC[C@@H](OC(C)(C)C)[C@H](C(=O)[SiH](C)C)O1.
What is the InChIKey of dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone?
The InChIKey is OAFFUSOKCPWHGW-VXRWAFEHSA-N. The full InChI is InChI=1S/C12H24O4Si/c1-8-14-7-9(16-12(2,3)4)10(15-8)11(13)17(5)6/h8-10,17H,7H2,1-6H3/t8?,9-,10-/m1/s1.
What are the key properties of dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone?
dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone has a molecular weight of 260.41 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilyl-[(4R,5R)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1,3-dioxan-4-yl]methanone is sourced from PubChem (CID 173206663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).