About 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene
1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 173206891) has the molecular formula C8H5F6I
and a molecular weight of 342.02 g/mol. Its IUPAC name is 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 173206891 |
| Molecular Formula | C8H5F6I |
| Molecular Weight | 342.02 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C1=CC(C(F)(F)F)CC(I)=C1 |
| InChI | InChI=1S/C8H5F6I/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-2,5H,3H2 |
| InChIKey | JJWOIKILHVQITB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.02 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene (CID 173206891) is 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene is FC(F)(F)C1=CC(C(F)(F)F)CC(I)=C1.
What is the InChIKey of 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is JJWOIKILHVQITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F6I/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-2,5H,3H2.
What are the key properties of 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 342.02 g/mol, XLogP of 4.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 173206891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).