About [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid
[(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid (PubChem CID 173207297) has the molecular formula C15H27O4PSi
and a molecular weight of 330.44 g/mol. Its IUPAC name is [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid.
Molecular Properties
| Compound Name | [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid |
| PubChem CID | 173207297 |
| Molecular Formula | C15H27O4PSi |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid |
| SMILES | Cc1cc(C(O[SiH](C)C)P(=O)(O)O)cc(C)c1C(C)(C)C |
| InChI | InChI=1S/C15H27O4PSi/c1-10-8-12(9-11(2)13(10)15(3,4)5)14(19-21(6)7)20(16,17)18/h8-9,14,21H,1-7H3,(H2,16,17,18) |
| InChIKey | QQSIKCHTZFSYRZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid?
The IUPAC name of [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid (CID 173207297) is [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid.
What is the SMILES notation for [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid?
The canonical SMILES for [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid is Cc1cc(C(O[SiH](C)C)P(=O)(O)O)cc(C)c1C(C)(C)C.
What is the InChIKey of [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid?
The InChIKey is QQSIKCHTZFSYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27O4PSi/c1-10-8-12(9-11(2)13(10)15(3,4)5)14(19-21(6)7)20(16,17)18/h8-9,14,21H,1-7H3,(H2,16,17,18).
What are the key properties of [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid?
[(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid has a molecular weight of 330.44 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-tert-butyl-3,5-dimethylphenyl)-dimethylsilyloxymethyl]phosphonic acid is sourced from PubChem (CID 173207297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).