C21H17N3O2S — CID 173207476
2-(1,4-diphenylpyrazol-3-yl)benzenesulfonamide (PubChem CID 173207476) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-(1,4-diphenylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 2-(1,4-diphenylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 173207476 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-(1,4-diphenylpyrazol-3-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1nn(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H17N3O2S/c22-27(25,26)20-14-8-7-13-18(20)21-19(16-9-3-1-4-10-16)15-24(23-21)17-11-5-2-6-12-17/h1-15H,(H2,22,25,26) |
| InChIKey | KDCPDBHLMHJCPJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |