C20H18ClNO3S — CID 173207541
2-[5-but-3-en-2-yl-4-(4-chlorophenyl)furan-3-yl]benzenesulfonamide (PubChem CID 173207541) has the molecular formula C20H18ClNO3S and a molecular weight of 387.89 g/mol. Its IUPAC name is 2-[5-but-3-en-2-yl-4-(4-chlorophenyl)furan-3-yl]benzenesulfonamide.
| Compound Name | 2-[5-but-3-en-2-yl-4-(4-chlorophenyl)furan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 173207541 |
| Molecular Formula | C20H18ClNO3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[5-but-3-en-2-yl-4-(4-chlorophenyl)furan-3-yl]benzenesulfonamide |
| SMILES | C=CC(C)c1occ(-c2ccccc2S(N)(=O)=O)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO3S/c1-3-13(2)20-19(14-8-10-15(21)11-9-14)17(12-25-20)16-6-4-5-7-18(16)26(22,23)24/h3-13H,1H2,2H3,(H2,22,23,24) |
| InChIKey | DHLSYDVEXNEBKT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|