C11H17F9OSi — CID 173207844
[1,1,1,8,8,8-hexafluoro-4-(3,3,3-trifluoropropyl)octan-4-yl]oxysilane (PubChem CID 173207844) has the molecular formula C11H17F9OSi and a molecular weight of 364.32 g/mol. Its IUPAC name is [1,1,1,8,8,8-hexafluoro-4-(3,3,3-trifluoropropyl)octan-4-yl]oxysilane.
| Compound Name | [1,1,1,8,8,8-hexafluoro-4-(3,3,3-trifluoropropyl)octan-4-yl]oxysilane |
|---|---|
| PubChem CID | 173207844 |
| Molecular Formula | C11H17F9OSi |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [1,1,1,8,8,8-hexafluoro-4-(3,3,3-trifluoropropyl)octan-4-yl]oxysilane |
| SMILES | FC(F)(F)CCCC(CCC(F)(F)F)(CCC(F)(F)F)O[SiH3] |
| InChI | InChI=1S/C11H17F9OSi/c12-9(13,14)3-1-2-8(21-22,4-6-10(15,16)17)5-7-11(18,19)20/h1-7H2,22H3 |
| InChIKey | YZOCSRJCKQCZPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|