About [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride
[cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride (PubChem CID 173207975) has the molecular formula C9H15Cl2OSiTi
and a molecular weight of 286.08 g/mol. Its IUPAC name is [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride.
Molecular Properties
| Compound Name | [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride |
| PubChem CID | 173207975 |
| Molecular Formula | C9H15Cl2OSiTi |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride |
| SMILES | COC(C1=[C-]CC=C1)[SiH](C)C.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C9H15OSi.2ClH.Ti/c1-10-9(11(2)3)8-6-4-5-7-8;;;/h4,6,9,11H,5H2,1-3H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | YSBOEXBAQUGJIY-UHFFFAOYSA-L |
| XLogP | -4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride?
The IUPAC name of [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride (CID 173207975) is [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride.
What is the SMILES notation for [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride?
The canonical SMILES for [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride is COC(C1=[C-]CC=C1)[SiH](C)C.[Cl-].[Cl-].[Ti+3].
What is the InChIKey of [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride?
The InChIKey is YSBOEXBAQUGJIY-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H15OSi.2ClH.Ti/c1-10-9(11(2)3)8-6-4-5-7-8;;;/h4,6,9,11H,5H2,1-3H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride?
[cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride has a molecular weight of 286.08 g/mol, XLogP of -4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane;titanium(3+);dichloride is sourced from PubChem (CID 173207975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).