About [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride
[butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride (PubChem CID 173208037) has the molecular formula C12H21Cl2OSiTi
and a molecular weight of 328.16 g/mol. Its IUPAC name is [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride.
Molecular Properties
| Compound Name | [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride |
| PubChem CID | 173208037 |
| Molecular Formula | C12H21Cl2OSiTi |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride |
| SMILES | CCCCOC(C1=[C-]CC=C1)[SiH](C)C.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C12H21OSi.2ClH.Ti/c1-4-5-10-13-12(14(2)3)11-8-6-7-9-11;;;/h6,8,12,14H,4-5,7,10H2,1-3H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | KPVSEHSLUVIBCP-UHFFFAOYSA-L |
| XLogP | -3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride?
The IUPAC name of [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride (CID 173208037) is [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride.
What is the SMILES notation for [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride?
The canonical SMILES for [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride is CCCCOC(C1=[C-]CC=C1)[SiH](C)C.[Cl-].[Cl-].[Ti+3].
What is the InChIKey of [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride?
The InChIKey is KPVSEHSLUVIBCP-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H21OSi.2ClH.Ti/c1-4-5-10-13-12(14(2)3)11-8-6-7-9-11;;;/h6,8,12,14H,4-5,7,10H2,1-3H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride?
[butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride has a molecular weight of 328.16 g/mol, XLogP of -3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [butoxy(cyclopenta-1,4-dien-1-yl)methyl]-dimethylsilane;titanium(3+);dichloride is sourced from PubChem (CID 173208037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).