C14H26O5Si — CID 173208042
(4S,5S)-5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one (PubChem CID 173208042) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is (4S,5S)-5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one.
| Compound Name | (4S,5S)-5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one |
|---|---|
| PubChem CID | 173208042 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (4S,5S)-5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one |
| SMILES | C[SiH](C)OC([C@H]1OC(=O)C[C@@H]1C1OCCO1)C(C)(C)C |
| InChI | InChI=1S/C14H26O5Si/c1-14(2,3)12(19-20(4)5)11-9(8-10(15)18-11)13-16-6-7-17-13/h9,11-13,20H,6-8H2,1-5H3/t9-,11-,12?/m0/s1 |
| InChIKey | CAGQDYLSFXVNBI-HFLPBZFISA-N |
| XLogP | 1.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|