C11H9F17OSi — CID 173208275
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-heptadecafluoroundecoxysilane (PubChem CID 173208275) has the molecular formula C11H9F17OSi and a molecular weight of 508.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-heptadecafluoroundecoxysilane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-heptadecafluoroundecoxysilane |
|---|---|
| PubChem CID | 173208275 |
| Molecular Formula | C11H9F17OSi |
| Molecular Weight | 508.24 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-heptadecafluoroundecoxysilane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO[SiH3] |
| InChI | InChI=1S/C11H9F17OSi/c1-3(12)5(15,16)7(19,20)9(23,24)11(27,28)10(25,26)8(21,22)6(17,18)4(13,14)2-29-30/h3H,2H2,1,30H3 |
| InChIKey | KYBHVNYGBVXSLM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|