C15H23Cl3Ti — CID 173208304
titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydroinden-1-ide;trichloride (PubChem CID 173208304) has the molecular formula C15H23Cl3Ti and a molecular weight of 357.58 g/mol. Its IUPAC name is titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydroinden-1-ide;trichloride.
| Compound Name | titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydroinden-1-ide;trichloride |
|---|---|
| PubChem CID | 173208304 |
| Molecular Formula | C15H23Cl3Ti |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | titanium(4+);1,2,3-triethyl-4,5,6,7-tetrahydroinden-1-ide;trichloride |
| SMILES | CCc1c2c([c-](CC)c1CC)CCCC2.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C15H23.3ClH.Ti/c1-4-11-12(5-2)14-9-7-8-10-15(14)13(11)6-3;;;;/h4-10H2,1-3H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | YVLXGEYONUPNFB-UHFFFAOYSA-K |
| XLogP | -5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | -5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|