C18H18Si — CID 173209715
9,9,10-trimethyl-3-phenyl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene (PubChem CID 173209715) has the molecular formula C18H18Si and a molecular weight of 262.43 g/mol. Its IUPAC name is 9,9,10-trimethyl-3-phenyl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene.
| Compound Name | 9,9,10-trimethyl-3-phenyl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene |
|---|---|
| PubChem CID | 173209715 |
| Molecular Formula | C18H18Si |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 9,9,10-trimethyl-3-phenyl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene |
| SMILES | CC1=C2c3c(-c4ccccc4)cccc3C1[Si]2(C)C |
| InChI | InChI=1S/C18H18Si/c1-12-17-15-11-7-10-14(13-8-5-4-6-9-13)16(15)18(12)19(17,2)3/h4-11,17H,1-3H3 |
| InChIKey | VDQJGJGSFOPSTK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|