About azane;tert-butyl 3-cyano-5-methylhex-3-enoate
azane;tert-butyl 3-cyano-5-methylhex-3-enoate (PubChem CID 173210410) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is azane;tert-butyl 3-cyano-5-methylhex-3-enoate.
Molecular Properties
| Compound Name | azane;tert-butyl 3-cyano-5-methylhex-3-enoate |
| PubChem CID | 173210410 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | azane;tert-butyl 3-cyano-5-methylhex-3-enoate |
| SMILES | CC(C)C=C(C#N)CC(=O)OC(C)(C)C.N |
| InChI | InChI=1S/C12H19NO2.H3N/c1-9(2)6-10(8-13)7-11(14)15-12(3,4)5;/h6,9H,7H2,1-5H3;1H3 |
| InChIKey | QAGXJDCGRHXEFQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze azane;tert-butyl 3-cyano-5-methylhex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tert-butyl 3-cyano-5-methylhex-3-enoate?
The IUPAC name of azane;tert-butyl 3-cyano-5-methylhex-3-enoate (CID 173210410) is azane;tert-butyl 3-cyano-5-methylhex-3-enoate.
What is the SMILES notation for azane;tert-butyl 3-cyano-5-methylhex-3-enoate?
The canonical SMILES for azane;tert-butyl 3-cyano-5-methylhex-3-enoate is CC(C)C=C(C#N)CC(=O)OC(C)(C)C.N.
What is the InChIKey of azane;tert-butyl 3-cyano-5-methylhex-3-enoate?
The InChIKey is QAGXJDCGRHXEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2.H3N/c1-9(2)6-10(8-13)7-11(14)15-12(3,4)5;/h6,9H,7H2,1-5H3;1H3.
What are the key properties of azane;tert-butyl 3-cyano-5-methylhex-3-enoate?
azane;tert-butyl 3-cyano-5-methylhex-3-enoate has a molecular weight of 226.32 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tert-butyl 3-cyano-5-methylhex-3-enoate is sourced from PubChem (CID 173210410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).