C29H36N2O7S2 — CID 173210437
4-[3,6-bis(diethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzene-1,3-disulfonic acid (PubChem CID 173210437) has the molecular formula C29H36N2O7S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is 4-[3,6-bis(diethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[3,6-bis(diethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 173210437 |
| Molecular Formula | C29H36N2O7S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 4-[3,6-bis(diethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzene-1,3-disulfonic acid |
| SMILES | CCN(CC)c1cc2c(cc1C)C(c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O)c1cc(C)c(N(CC)CC)cc1O2 |
| InChI | InChI=1S/C29H36N2O7S2/c1-7-30(8-2)24-16-26-22(13-18(24)5)29(21-12-11-20(39(32,33)34)15-28(21)40(35,36)37)23-14-19(6)25(17-27(23)38-26)31(9-3)10-4/h11-17,29H,7-10H2,1-6H3,(H,32,33,34)(H,35,36,37) |
| InChIKey | DCRCSSBYBKUTNG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|