About 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one
5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one (PubChem CID 173210548) has the molecular formula C14H26O5Si
and a molecular weight of 302.44 g/mol. Its IUPAC name is 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one.
Molecular Properties
| Compound Name | 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one |
| PubChem CID | 173210548 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one |
| SMILES | C[SiH](C)OC(C1OC(=O)CC1C1OCCO1)C(C)(C)C |
| InChI | InChI=1S/C14H26O5Si/c1-14(2,3)12(19-20(4)5)11-9(8-10(15)18-11)13-16-6-7-17-13/h9,11-13,20H,6-8H2,1-5H3 |
| InChIKey | CAGQDYLSFXVNBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one?
The IUPAC name of 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one (CID 173210548) is 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one.
What is the SMILES notation for 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one?
The canonical SMILES for 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one is C[SiH](C)OC(C1OC(=O)CC1C1OCCO1)C(C)(C)C.
What is the InChIKey of 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one?
The InChIKey is CAGQDYLSFXVNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5Si/c1-14(2,3)12(19-20(4)5)11-9(8-10(15)18-11)13-16-6-7-17-13/h9,11-13,20H,6-8H2,1-5H3.
What are the key properties of 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one?
5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one has a molecular weight of 302.44 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-(1,3-dioxolan-2-yl)oxolan-2-one is sourced from PubChem (CID 173210548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).