About [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane
[1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane (PubChem CID 173211163) has the molecular formula C8H12Br2Si
and a molecular weight of 296.08 g/mol. Its IUPAC name is [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane.
Molecular Properties
| Compound Name | [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane |
| PubChem CID | 173211163 |
| Molecular Formula | C8H12Br2Si |
| Molecular Weight | 296.08 g/mol |
| Exact Mass | 293.91 |
| IUPAC Name | [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane |
| SMILES | [SiH3]C1(CBr)C=CC(CBr)=CC1 |
| InChI | InChI=1S/C8H12Br2Si/c9-5-7-1-3-8(11,6-10)4-2-7/h1-3H,4-6H2,11H3 |
| InChIKey | RVVXOCZSROABRY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane?
The IUPAC name of [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane (CID 173211163) is [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane.
What is the SMILES notation for [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane?
The canonical SMILES for [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane is [SiH3]C1(CBr)C=CC(CBr)=CC1.
What is the InChIKey of [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane?
The InChIKey is RVVXOCZSROABRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Br2Si/c9-5-7-1-3-8(11,6-10)4-2-7/h1-3H,4-6H2,11H3.
What are the key properties of [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane?
[1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane has a molecular weight of 296.08 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-bis(bromomethyl)cyclohexa-2,4-dien-1-yl]silane is sourced from PubChem (CID 173211163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).