About dibromozirconium;1H-inden-1-ide
dibromozirconium;1H-inden-1-ide (PubChem CID 173211982) has the molecular formula C9H7Br2Zr-
and a molecular weight of 366.19 g/mol. Its IUPAC name is dibromozirconium;1H-inden-1-ide.
Molecular Properties
| Compound Name | dibromozirconium;1H-inden-1-ide |
| PubChem CID | 173211982 |
| Molecular Formula | C9H7Br2Zr- |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 362.80 |
| IUPAC Name | dibromozirconium;1H-inden-1-ide |
| SMILES | Br[Zr]Br.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2BrH.Zr/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-7H;2*1H;/q-1;;;+2/p-2 |
| InChIKey | ROWBDISPOJHHGE-UHFFFAOYSA-L |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dibromozirconium;1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromozirconium;1H-inden-1-ide?
The IUPAC name of dibromozirconium;1H-inden-1-ide (CID 173211982) is dibromozirconium;1H-inden-1-ide.
What is the SMILES notation for dibromozirconium;1H-inden-1-ide?
The canonical SMILES for dibromozirconium;1H-inden-1-ide is Br[Zr]Br.c1ccc2[cH-]ccc2c1.
What is the InChIKey of dibromozirconium;1H-inden-1-ide?
The InChIKey is ROWBDISPOJHHGE-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7.2BrH.Zr/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-7H;2*1H;/q-1;;;+2/p-2.
What are the key properties of dibromozirconium;1H-inden-1-ide?
dibromozirconium;1H-inden-1-ide has a molecular weight of 366.19 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromozirconium;1H-inden-1-ide is sourced from PubChem (CID 173211982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).