C9H16OSi — CID 173212243
2-(5-dimethylsilylcyclopenta-1,4-dien-1-yl)ethanol (PubChem CID 173212243) has the molecular formula C9H16OSi and a molecular weight of 168.31 g/mol. Its IUPAC name is 2-(5-dimethylsilylcyclopenta-1,4-dien-1-yl)ethanol.
| Compound Name | 2-(5-dimethylsilylcyclopenta-1,4-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 173212243 |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(5-dimethylsilylcyclopenta-1,4-dien-1-yl)ethanol |
| SMILES | C[SiH](C)C1=CCC=C1CCO |
| InChI | InChI=1S/C9H16OSi/c1-11(2)9-5-3-4-8(9)6-7-10/h4-5,10-11H,3,6-7H2,1-2H3 |
| InChIKey | RZILHIMLCPKMOY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|