About 3-hydroxyhepta-1,6-dien-4-one
3-hydroxyhepta-1,6-dien-4-one (PubChem CID 173212429) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 3-hydroxyhepta-1,6-dien-4-one.
Molecular Properties
| Compound Name | 3-hydroxyhepta-1,6-dien-4-one |
| PubChem CID | 173212429 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 3-hydroxyhepta-1,6-dien-4-one |
| SMILES | C=CCC(=O)C(O)C=C |
| InChI | InChI=1S/C7H10O2/c1-3-5-7(9)6(8)4-2/h3-4,6,8H,1-2,5H2 |
| InChIKey | UXSMNFWIPIJHGF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyhepta-1,6-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhepta-1,6-dien-4-one?
The IUPAC name of 3-hydroxyhepta-1,6-dien-4-one (CID 173212429) is 3-hydroxyhepta-1,6-dien-4-one.
What is the SMILES notation for 3-hydroxyhepta-1,6-dien-4-one?
The canonical SMILES for 3-hydroxyhepta-1,6-dien-4-one is C=CCC(=O)C(O)C=C.
What is the InChIKey of 3-hydroxyhepta-1,6-dien-4-one?
The InChIKey is UXSMNFWIPIJHGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-5-7(9)6(8)4-2/h3-4,6,8H,1-2,5H2.
What are the key properties of 3-hydroxyhepta-1,6-dien-4-one?
3-hydroxyhepta-1,6-dien-4-one has a molecular weight of 126.15 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhepta-1,6-dien-4-one is sourced from PubChem (CID 173212429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).