About 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate
8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate (PubChem CID 173212527) has the molecular formula C16H32O5
and a molecular weight of 304.43 g/mol. Its IUPAC name is 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate.
Molecular Properties
| Compound Name | 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate |
| PubChem CID | 173212527 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate |
| SMILES | CCC(CCCCCO)OC(=O)CCCCCOCOC |
| InChI | InChI=1S/C16H32O5/c1-3-15(10-6-4-8-12-17)21-16(18)11-7-5-9-13-20-14-19-2/h15,17H,3-14H2,1-2H3 |
| InChIKey | YFVJYOWNSBVSHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate?
The IUPAC name of 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate (CID 173212527) is 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate.
What is the SMILES notation for 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate?
The canonical SMILES for 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate is CCC(CCCCCO)OC(=O)CCCCCOCOC.
What is the InChIKey of 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate?
The InChIKey is YFVJYOWNSBVSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O5/c1-3-15(10-6-4-8-12-17)21-16(18)11-7-5-9-13-20-14-19-2/h15,17H,3-14H2,1-2H3.
What are the key properties of 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate?
8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate has a molecular weight of 304.43 g/mol, XLogP of 3.04, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoctan-3-yl 6-(methoxymethoxy)hexanoate is sourced from PubChem (CID 173212527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).