C15H22ClNO4 — CID 173213108
[(2S,3S,4R)-4-(2-chloroethyl)-2-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-3-methyl-5-oxopyrrolidin-3-yl] formate (PubChem CID 173213108) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is [(2S,3S,4R)-4-(2-chloroethyl)-2-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-3-methyl-5-oxopyrrolidin-3-yl] formate.
| Compound Name | [(2S,3S,4R)-4-(2-chloroethyl)-2-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-3-methyl-5-oxopyrrolidin-3-yl] formate |
|---|---|
| PubChem CID | 173213108 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [(2S,3S,4R)-4-(2-chloroethyl)-2-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-3-methyl-5-oxopyrrolidin-3-yl] formate |
| SMILES | C[C@]1(OC=O)[C@@H](CCCl)C(=O)N[C@H]1[C@@H](O)C1C=CCCC1 |
| InChI | InChI=1S/C15H22ClNO4/c1-15(21-9-18)11(7-8-16)14(20)17-13(15)12(19)10-5-3-2-4-6-10/h3,5,9-13,19H,2,4,6-8H2,1H3,(H,17,20)/t10?,11-,12-,13-,15-/m0/s1 |
| InChIKey | UWIANNZMCANVMQ-WSEMLCSKSA-N |
| XLogP | 1.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|