C15H16ClN5 — CID 173213702
N-[(7-chloro-3,4-dihydro-2H-cyclopenta[b]indol-1-ylidene)amino]-1-(4,5-dihydro-1H-imidazol-2-yl)methanamine (PubChem CID 173213702) has the molecular formula C15H16ClN5 and a molecular weight of 301.78 g/mol. Its IUPAC name is N-[(7-chloro-3,4-dihydro-2H-cyclopenta[b]indol-1-ylidene)amino]-1-(4,5-dihydro-1H-imidazol-2-yl)methanamine.
| Compound Name | N-[(7-chloro-3,4-dihydro-2H-cyclopenta[b]indol-1-ylidene)amino]-1-(4,5-dihydro-1H-imidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 173213702 |
| Molecular Formula | C15H16ClN5 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(7-chloro-3,4-dihydro-2H-cyclopenta[b]indol-1-ylidene)amino]-1-(4,5-dihydro-1H-imidazol-2-yl)methanamine |
| SMILES | Clc1ccc2[nH]c3c(c2c1)C(=NNCC1=NCCN1)CC3 |
| InChI | InChI=1S/C15H16ClN5/c16-9-1-2-11-10(7-9)15-12(20-11)3-4-13(15)21-19-8-14-17-5-6-18-14/h1-2,7,19-20H,3-6,8H2,(H,17,18) |
| InChIKey | VZVDHCNQWDPPBW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|