About 8-hexoxyoxecan-3-ol
8-hexoxyoxecan-3-ol (PubChem CID 173215315) has the molecular formula C15H30O3
and a molecular weight of 258.40 g/mol. Its IUPAC name is 8-hexoxyoxecan-3-ol.
Molecular Properties
| Compound Name | 8-hexoxyoxecan-3-ol |
| PubChem CID | 173215315 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 8-hexoxyoxecan-3-ol |
| SMILES | CCCCCCOC1CCCCC(O)COCC1 |
| InChI | InChI=1S/C15H30O3/c1-2-3-4-7-11-18-15-9-6-5-8-14(16)13-17-12-10-15/h14-16H,2-13H2,1H3 |
| InChIKey | YDJFDXXDXGBYEB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-hexoxyoxecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hexoxyoxecan-3-ol?
The IUPAC name of 8-hexoxyoxecan-3-ol (CID 173215315) is 8-hexoxyoxecan-3-ol.
What is the SMILES notation for 8-hexoxyoxecan-3-ol?
The canonical SMILES for 8-hexoxyoxecan-3-ol is CCCCCCOC1CCCCC(O)COCC1.
What is the InChIKey of 8-hexoxyoxecan-3-ol?
The InChIKey is YDJFDXXDXGBYEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3/c1-2-3-4-7-11-18-15-9-6-5-8-14(16)13-17-12-10-15/h14-16H,2-13H2,1H3.
What are the key properties of 8-hexoxyoxecan-3-ol?
8-hexoxyoxecan-3-ol has a molecular weight of 258.40 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hexoxyoxecan-3-ol is sourced from PubChem (CID 173215315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).