About 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane
5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane (PubChem CID 173215387) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane.
Analyze 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane?
The IUPAC name of 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane (CID 173215387) is 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane.
What is the SMILES notation for 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane?
The canonical SMILES for 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane is CCC(C)(C)CC1OC2CC3CC2CC3O1.
What is the InChIKey of 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane?
The InChIKey is GIUIPRZFWLSGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-4-14(2,3)8-13-15-11-6-9-5-10(11)7-12(9)16-13/h9-13H,4-8H2,1-3H3.
What are the key properties of 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane?
5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane has a molecular weight of 224.34 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylbutyl)-4,6-dioxatricyclo[5.3.0.03,9]decane is sourced from PubChem (CID 173215387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).