About 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene
5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene (PubChem CID 173216228) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene |
| PubChem CID | 173216228 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=CC(C)(c2ccccc2)C1C |
| InChI | InChI=1S/C17H22/c1-4-9-15-10-8-13-17(3,14(15)2)16-11-6-5-7-12-16/h5-8,10-14H,4,9H2,1-3H3 |
| InChIKey | RPUTXRJDZYTHTD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene?
The IUPAC name of 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene (CID 173216228) is 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene.
What is the SMILES notation for 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene?
The canonical SMILES for 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene is CCCC1=CC=CC(C)(c2ccccc2)C1C.
What is the InChIKey of 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene?
The InChIKey is RPUTXRJDZYTHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22/c1-4-9-15-10-8-13-17(3,14(15)2)16-11-6-5-7-12-16/h5-8,10-14H,4,9H2,1-3H3.
What are the key properties of 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene?
5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene has a molecular weight of 226.36 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-5-phenyl-1-propylcyclohexa-1,3-diene is sourced from PubChem (CID 173216228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).