About [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate
[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate (PubChem CID 173216330) has the molecular formula C19H27Cl2NO3
and a molecular weight of 388.34 g/mol. Its IUPAC name is [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate.
Molecular Properties
| Compound Name | [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate |
| PubChem CID | 173216330 |
| Molecular Formula | C19H27Cl2NO3 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OC(C)=NOC(C)(C)C |
| InChI | InChI=1S/C19H27Cl2NO3/c1-7-14-11-16(23-10-9-17(20)21)12-15(8-2)18(14)24-13(3)22-25-19(4,5)6/h9,11-12H,7-8,10H2,1-6H3 |
| InChIKey | QSBDDXAOEZSKSY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate?
The IUPAC name of [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate (CID 173216330) is [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate.
What is the SMILES notation for [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate?
The canonical SMILES for [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate is CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OC(C)=NOC(C)(C)C.
What is the InChIKey of [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate?
The InChIKey is QSBDDXAOEZSKSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27Cl2NO3/c1-7-14-11-16(23-10-9-17(20)21)12-15(8-2)18(14)24-13(3)22-25-19(4,5)6/h9,11-12H,7-8,10H2,1-6H3.
What are the key properties of [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate?
[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate has a molecular weight of 388.34 g/mol, XLogP of 6.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenyl] N-[(2-methylpropan-2-yl)oxy]ethanimidate is sourced from PubChem (CID 173216330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).