C9H9F13OSi — CID 173217121
2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorononoxysilane (PubChem CID 173217121) has the molecular formula C9H9F13OSi and a molecular weight of 408.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorononoxysilane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorononoxysilane |
|---|---|
| PubChem CID | 173217121 |
| Molecular Formula | C9H9F13OSi |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorononoxysilane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO[SiH3] |
| InChI | InChI=1S/C9H9F13OSi/c1-3(10)5(13,14)7(17,18)9(21,22)8(19,20)6(15,16)4(11,12)2-23-24/h3H,2H2,1,24H3 |
| InChIKey | XHGLSXYIXKAVKV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|