C27H33F2NO7 — CID 173217745
2-[[carboxy(hydroxy)methyl]-(cyclobutylmethyl)-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]azaniumyl]-2-hydroxyacetate (PubChem CID 173217745) has the molecular formula C27H33F2NO7 and a molecular weight of 521.56 g/mol. Its IUPAC name is 2-[[carboxy(hydroxy)methyl]-(cyclobutylmethyl)-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]azaniumyl]-2-hydroxyacetate.
| Compound Name | 2-[[carboxy(hydroxy)methyl]-(cyclobutylmethyl)-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]azaniumyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 173217745 |
| Molecular Formula | C27H33F2NO7 |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-[[carboxy(hydroxy)methyl]-(cyclobutylmethyl)-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]azaniumyl]-2-hydroxyacetate |
| SMILES | Cc1cccc(C)c1C(COCc1c(F)cccc1F)C[N+](CC1CCC1)(C(O)C(=O)[O-])C(O)C(=O)O |
| InChI | InChI=1S/C27H33F2NO7/c1-16-6-3-7-17(2)23(16)19(14-37-15-20-21(28)10-5-11-22(20)29)13-30(24(31)26(33)34,25(32)27(35)36)12-18-8-4-9-18/h3,5-7,10-11,18-19,24-25,31-32H,4,8-9,12-15H2,1-2H3,(H-,33,34,35,36) |
| InChIKey | LEVDVJGWCRSWCS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|