About 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole
5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole (PubChem CID 173217873) has the molecular formula C22H27NO2S
and a molecular weight of 369.53 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole |
| PubChem CID | 173217873 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole |
| SMILES | Cc1c(CCC(C)(C)C)c2cc(S(=O)(=O)c3ccccc3)ccc2n1C |
| InChI | InChI=1S/C22H27NO2S/c1-16-19(13-14-22(2,3)4)20-15-18(11-12-21(20)23(16)5)26(24,25)17-9-7-6-8-10-17/h6-12,15H,13-14H2,1-5H3 |
| InChIKey | AKCBEKRPSVQLFI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole?
The IUPAC name of 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole (CID 173217873) is 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole.
What is the SMILES notation for 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole?
The canonical SMILES for 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole is Cc1c(CCC(C)(C)C)c2cc(S(=O)(=O)c3ccccc3)ccc2n1C.
What is the InChIKey of 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole?
The InChIKey is AKCBEKRPSVQLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2S/c1-16-19(13-14-22(2,3)4)20-15-18(11-12-21(20)23(16)5)26(24,25)17-9-7-6-8-10-17/h6-12,15H,13-14H2,1-5H3.
What are the key properties of 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole?
5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole has a molecular weight of 369.53 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-3-(3,3-dimethylbutyl)-1,2-dimethylindole is sourced from PubChem (CID 173217873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).