C22H25F2NO2S — CID 173217893
5-(3,5-difluorophenyl)sulfonyl-3-(3,3-dimethylbutan-2-yl)-1,2-dimethylindole (PubChem CID 173217893) has the molecular formula C22H25F2NO2S and a molecular weight of 405.51 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)sulfonyl-3-(3,3-dimethylbutan-2-yl)-1,2-dimethylindole.
| Compound Name | 5-(3,5-difluorophenyl)sulfonyl-3-(3,3-dimethylbutan-2-yl)-1,2-dimethylindole |
|---|---|
| PubChem CID | 173217893 |
| Molecular Formula | C22H25F2NO2S |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 5-(3,5-difluorophenyl)sulfonyl-3-(3,3-dimethylbutan-2-yl)-1,2-dimethylindole |
| SMILES | Cc1c(C(C)C(C)(C)C)c2cc(S(=O)(=O)c3cc(F)cc(F)c3)ccc2n1C |
| InChI | InChI=1S/C22H25F2NO2S/c1-13(22(3,4)5)21-14(2)25(6)20-8-7-17(12-19(20)21)28(26,27)18-10-15(23)9-16(24)11-18/h7-13H,1-6H3 |
| InChIKey | XLECVSDQNLHVFW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|