C26H26N2O7 — CID 173217934
4-[3-[3,5-dimethoxy-4-[[2-(2-phenylethenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propyl]-1,3-oxazolidine-2,5-dione (PubChem CID 173217934) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-[3-[3,5-dimethoxy-4-[[2-(2-phenylethenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[3-[3,5-dimethoxy-4-[[2-(2-phenylethenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 173217934 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 4-[3-[3,5-dimethoxy-4-[[2-(2-phenylethenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propyl]-1,3-oxazolidine-2,5-dione |
| SMILES | COc1cc(CCCC2NC(=O)OC2=O)cc(OC)c1OCc1coc(C=Cc2ccccc2)n1 |
| InChI | InChI=1S/C26H26N2O7/c1-31-21-13-18(9-6-10-20-25(29)35-26(30)28-20)14-22(32-2)24(21)34-16-19-15-33-23(27-19)12-11-17-7-4-3-5-8-17/h3-5,7-8,11-15,20H,6,9-10,16H2,1-2H3,(H,28,30) |
| InChIKey | QPMUPYRPSPRMKZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|