C30H29N3O3 — CID 173218302
N-[5-[2-pyridin-4-yl-5-[4-(2-pyrrolidin-2-ylethoxy)phenyl]furan-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 173218302) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[5-[2-pyridin-4-yl-5-[4-(2-pyrrolidin-2-ylethoxy)phenyl]furan-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[2-pyridin-4-yl-5-[4-(2-pyrrolidin-2-ylethoxy)phenyl]furan-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 173218302 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-[5-[2-pyridin-4-yl-5-[4-(2-pyrrolidin-2-ylethoxy)phenyl]furan-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCc2cc(-c3cc(-c4ccc(OCCC5CCCN5)cc4)oc3-c3ccncc3)ccc21 |
| InChI | InChI=1S/C30H29N3O3/c34-33-28-10-6-22-18-23(5-9-26(22)28)27-19-29(36-30(27)21-11-15-31-16-12-21)20-3-7-25(8-4-20)35-17-13-24-2-1-14-32-24/h3-5,7-9,11-12,15-16,18-19,24,32,34H,1-2,6,10,13-14,17H2 |
| InChIKey | NAAAGLXNXACOLZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|