About 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid
2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid (PubChem CID 173219176) has the molecular formula C17H16N4O2S
and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid.
Molecular Properties
| Compound Name | 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid |
| PubChem CID | 173219176 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid |
| SMILES | O=C(O)CN(c1ccccc1)n1ncnc1SCc1ccccc1 |
| InChI | InChI=1S/C17H16N4O2S/c22-16(23)11-20(15-9-5-2-6-10-15)21-17(18-13-19-21)24-12-14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,22,23) |
| InChIKey | DBCBTUCFDSXWFO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid?
The IUPAC name of 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid (CID 173219176) is 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid.
What is the SMILES notation for 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid?
The canonical SMILES for 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid is O=C(O)CN(c1ccccc1)n1ncnc1SCc1ccccc1.
What is the InChIKey of 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid?
The InChIKey is DBCBTUCFDSXWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2S/c22-16(23)11-20(15-9-5-2-6-10-15)21-17(18-13-19-21)24-12-14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,22,23).
What are the key properties of 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid?
2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid has a molecular weight of 340.41 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-(5-benzylsulfanyl-1,2,4-triazol-1-yl)anilino)acetic acid is sourced from PubChem (CID 173219176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).