C10H16F2N2 — CID 173219378
N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 173219378) has the molecular formula C10H16F2N2 and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 173219378 |
| Molecular Formula | C10H16F2N2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNC1(F)C=CC(F)=CC1 |
| InChI | InChI=1S/C10H16F2N2/c1-14(2)8-7-13-10(12)5-3-9(11)4-6-10/h3-5,13H,6-8H2,1-2H3 |
| InChIKey | UBJGFLMBODNWFW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|