About 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde
2-chloro-1,2-dihydropyrimidine-5-carbaldehyde (PubChem CID 173219527) has the molecular formula C5H5ClN2O
and a molecular weight of 144.56 g/mol. Its IUPAC name is 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde |
| PubChem CID | 173219527 |
| Molecular Formula | C5H5ClN2O |
| Molecular Weight | 144.56 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde |
| SMILES | O=CC1=CNC(Cl)N=C1 |
| InChI | InChI=1S/C5H5ClN2O/c6-5-7-1-4(3-9)2-8-5/h1-3,5,7H |
| InChIKey | CXLDVICZVCFYSJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.56 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde?
The IUPAC name of 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde (CID 173219527) is 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde.
What is the SMILES notation for 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde?
The canonical SMILES for 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde is O=CC1=CNC(Cl)N=C1.
What is the InChIKey of 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde?
The InChIKey is CXLDVICZVCFYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2O/c6-5-7-1-4(3-9)2-8-5/h1-3,5,7H.
What are the key properties of 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde?
2-chloro-1,2-dihydropyrimidine-5-carbaldehyde has a molecular weight of 144.56 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,2-dihydropyrimidine-5-carbaldehyde is sourced from PubChem (CID 173219527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).